|
| | AC-262536 Basic information |
| Product Name: | AC-262536 | | Synonyms: | AC-262536;AC-262,356;4-(3-endo-Hydroxy-8-azabicyclo[3.2.1]oct-8-yl)naphthalene-1-carbonitrile;4-[(3-endo)-3-Hydroxy-8-azabicyclo[3.2.1]oct-8-yl]naphthalene-1-carbonitrile;AC262;AC-262536;AC262;AC-262536 powder;4-(3-hydroxy-8-azabicyclo[3.2.1]oct-8-yl)naphthalene-1-carbonitrile | | CAS: | 870888-46-3 | | MF: | C18H18N2O | | MW: | 278.36 | | EINECS: | 870888-460-3 | | Product Categories: | 870888-46-3 | | Mol File: | 870888-46-3.mol |  |
| | AC-262536 Chemical Properties |
| Melting point | 158-162°C | | Boiling point | 526.0±45.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: Soluble | | form | neat | | pka | 14.73±0.20(Predicted) | | InChI | InChI=1/C18H18N2O/c19-11-12-5-8-18(17-4-2-1-3-16(12)17)20-13-6-7-14(20)10-15(21)9-13/h1-5,8,13-15,21H,6-7,9-10H2/t13-,14+,15+ | | InChIKey | ATKWLNSCJYLXPF-FICVDOATNA-N | | SMILES | O[C@H]1C[C@H]2CC[C@H](N2C2=CC=C(C#N)C3C=CC=CC2=3)C1 |&1:1,3,6,r| |
| | AC-262536 Usage And Synthesis |
| Uses | AC-262536 is a hydrocarbon organic matter and can be used as pharmaceutical intermediates. |
| | AC-262536 Preparation Products And Raw materials |
|
