|
| | 3,5-Bis(tert-butyl)benzaldehyde Basic information |
| Product Name: | 3,5-Bis(tert-butyl)benzaldehyde | | Synonyms: | RARECHEM AQ A2 0001;3,5-BIS(TERT-BUTYL)BENZALDEHYDE;3,5-DI-TERT-BUTYL-BENZALDEHYDE;3,5-BIS(TERT-BUTYL)BENZALDEHYDE 97%;3,5-BIS(TERT-BUTYL)BENZLDEHYDE;3,5-Bis(tert-butyl)benzaldehyde,97%;3,5-Bis(tert-butyl)benzaldehyde3,5-Di-tert-butylbenzaldehyde;3,5-Di-tert-butylbenzaldehyde, >=98% | | CAS: | 17610-00-3 | | MF: | C15H22O | | MW: | 218.33 | | EINECS: | 639-397-6 | | Product Categories: | Building Blocks;C13-C60;Porphyrins;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks;Aldehydes;Phenyls & Phenyl-Het;Phenyls & Phenyl-Het | | Mol File: | 17610-00-3.mol |  |
| | 3,5-Bis(tert-butyl)benzaldehyde Chemical Properties |
| Melting point | 85-89 °C(lit.) | | Boiling point | 132°C/5mmHg(lit.) | | density | 0.9445 (rough estimate) | | refractive index | 1.5410 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | λmax | 296nm(CHCl3)(lit.) | | InChI | InChI=1S/C15H22O/c1-14(2,3)12-7-11(10-16)8-13(9-12)15(4,5)6/h7-10H,1-6H3 | | InChIKey | BRUITYMDHWNCIG-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 | | CAS DataBase Reference | 17610-00-3(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29122990 |
| | 3,5-Bis(tert-butyl)benzaldehyde Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | 3,5-Di-tert-butylbenzaldehyde may be used in the synthesis of the following:
- 5-p-pyridyl-15-(3,5-di-tert-butylphenyl)porphyrin via condensation reaction with 4-pyridinecarboxaldehyde and 2,2′-dipyrrylmethane
- 3,5-di-tert-butylphenyl-dipyrromethane via reaction with pyrrole in the presence of trifluoroacetic acid
- 3,5-di-tert-butyl-2-nitrobenzaldehyde via nitration reaction
|
| | 3,5-Bis(tert-butyl)benzaldehyde Preparation Products And Raw materials |
|
