|
| | (aR,3aS,4S,6S,7aR)-Hexahydro-3a,8,8-trimethyl-alpha-(2-methylpropyl)-4,6-methano-1,3,2-benzodioxaborole-2-methanamine 2,2,2-trifluoroacetate Basic information |
| Product Name: | (aR,3aS,4S,6S,7aR)-Hexahydro-3a,8,8-trimethyl-alpha-(2-methylpropyl)-4,6-methano-1,3,2-benzodioxaborole-2-methanamine 2,2,2-trifluoroacetate | | Synonyms: | (1R)-(S)-PINANEDIOL 1-AMMONIUM TRIFLUOROACETATE-3-METHYLBUTANE-1-BORONATE;(R)-BoroLeu-(+)-Pinanediol-CF3COOH;(R)-BoroLeu-(+)-Pinanediol-CF3CO2H;(aR,3aS,4S,6S,7aR)-Hexahydro-3a,8,8-trimethyl-alpha-(2-methylpropyl)-4,6-methano-1,3,2-benzodioxaborole-2-methanamine 2,2,2-trifluoroacetate;(αR)-(1S,2S,3R,5S)-Pinanediol-1-amino-3-methylbutane-1-boronate Trifluoroacetate;Bortezomib Intermediate 1;(R)-BoroLeu-(+)-Pinanediol trifluoroacetate;(αR,3aS,4S,6S,7aR)- | | CAS: | 179324-87-9 | | MF: | C17H29BF3NO4 | | MW: | 379.23 | | EINECS: | 2017-001-1 | | Product Categories: | Amines;Boron Derivatives;Chiral Reagents;Intermediates | | Mol File: | 179324-87-9.mol |  |
| | (aR,3aS,4S,6S,7aR)-Hexahydro-3a,8,8-trimethyl-alpha-(2-methylpropyl)-4,6-methano-1,3,2-benzodioxaborole-2-methanamine 2,2,2-trifluoroacetate Chemical Properties |
| Melting point | 157-159°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Ethanol (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1/C15H28BNO2.C2HF3O2/c1-9(2)6-13(17)16-18-12-8-10-7-11(14(10,3)4)15(12,5)19-16;3-2(4,5)1(6)7/h9-13H,6-8,17H2,1-5H3;(H,6,7)/t10-,11-,12+,13-,15-;/s3 | | InChIKey | SRFQKJZNJYTMNI-XXOUUVOINA-N | | SMILES | C(F)(F)(F)C(=O)O.C[C@@]12OB([C@@H](N)CC(C)C)O[C@]1([H])C[C@]1([H])C[C@@]2([H])C1(C)C |&1:8,11,18,21,24,r| | | CAS DataBase Reference | 179324-87-9(CAS DataBase Reference) |
| | (aR,3aS,4S,6S,7aR)-Hexahydro-3a,8,8-trimethyl-alpha-(2-methylpropyl)-4,6-methano-1,3,2-benzodioxaborole-2-methanamine 2,2,2-trifluoroacetate Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Bortezomib intermediate | | Uses | Bortezomib (B675700) intermediate. A boronic acid dipeptide derivative as proteasome inhibitors. |
| | (aR,3aS,4S,6S,7aR)-Hexahydro-3a,8,8-trimethyl-alpha-(2-methylpropyl)-4,6-methano-1,3,2-benzodioxaborole-2-methanamine 2,2,2-trifluoroacetate Preparation Products And Raw materials |
|