|
| | 5-(4-Chlorobutyl)-1-cyclohexanyl tetrazole Basic information |
| | 5-(4-Chlorobutyl)-1-cyclohexanyl tetrazole Chemical Properties |
| Melting point | 49-52°C | | Boiling point | 425.2±24.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 1.23±0.10(Predicted) | | InChI | InChI=1S/C11H19ClN4/c12-9-5-4-8-11-13-14-15-16(11)10-6-2-1-3-7-10/h10H,1-9H2 | | InChIKey | INTQSGGUSUSCTJ-UHFFFAOYSA-N | | SMILES | N1(C2CCCCC2)C(CCCCCl)=NN=N1 | | CAS DataBase Reference | 73963-42-5(CAS DataBase Reference) |
| | 5-(4-Chlorobutyl)-1-cyclohexanyl tetrazole Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | An impurity of Cilostazol. | | Uses | An impurity of Cilostazol (C441500(P)), which is a potent phosphodiesterase III A (PDE3A) inhibitor (IC50=0.2uM) and inhibitor of adenosine uptake. Has antimitogenic, antithrombotic, vasodilatory and cardiotonic properties and affects lipid levels in vivo. |
| | 5-(4-Chlorobutyl)-1-cyclohexanyl tetrazole Preparation Products And Raw materials |
|