|
| | 3-BROMOBENZENE-1,2-DIOL Basic information |
| Product Name: | 3-BROMOBENZENE-1,2-DIOL | | Synonyms: | 3-BROMOBENZENE-1,2-DIOL;2,3-dihydroxy-broMobenzene;1-Bromo-2,3-dihydroxybenzene;Phloroglucinol Impurity 30;3-Bromocatechol >;1,2-Benzenediol, 3-bromo-;3-bromo-1,2-benzenediol;3-BROMOBENZENE-1,2-DIOL ISO 9001：2015 REACH | | CAS: | 14381-51-2 | | MF: | C6H5BrO2 | | MW: | 189.01 | | EINECS: | | | Product Categories: | 1 | | Mol File: | 14381-51-2.mol |  |
| | 3-BROMOBENZENE-1,2-DIOL Chemical Properties |
| Melting point | 40-41℃ | | Boiling point | 243℃ | | density | 1.844 | | Fp | 101℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in organic solvents. | | pka | 8.26±0.10(Predicted) | | form | powder to crystal | | color | White to Gray to Brown | | InChI | InChI=1S/C6H5BrO2/c7-4-2-1-3-5(8)6(4)9/h1-3,8-9H | | InChIKey | JPBDMIWPTFDFEU-UHFFFAOYSA-N | | SMILES | C1(O)=CC=CC(Br)=C1O | | CAS DataBase Reference | 14381-51-2 |
| | 3-BROMOBENZENE-1,2-DIOL Usage And Synthesis |
| Chemical Properties | Needle-like crystals | | Uses | 3-Bromocatechol, is used as a drug and agrochemicals intermediate, Pharmaceutical intermediate. | | Synthesis Reference(s) | Journal of the American Chemical Society, 69, p. 2241, 1947 DOI: 10.1021/ja01201a514 |
| | 3-BROMOBENZENE-1,2-DIOL Preparation Products And Raw materials |
|
