|
| | N-Boc-N'-nitro-L-arginine Basic information |
| | N-Boc-N'-nitro-L-arginine Chemical Properties |
| Melting point | 111-113 °C | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Sparingly), Methanol (Slightly, Heated) | | form | Solid | | pka | 3.84±0.50(Predicted) | | color | White to Off-White | | BRN | 2015163 | | InChI | InChI=1S/C11H21N5O6/c1-11(2,3)22-10(19)14-7(8(17)18)5-4-6-13-9(12)15-16(20)21/h7H,4-6H2,1-3H3,(H,14,19)(H,17,18)(H3,12,13,15)/t7-/m0/s1 | | InChIKey | OZSSOVRIEPAIMP-ZETCQYMHSA-N | | SMILES | C(O)(=O)[C@H](CCCNC(=N)N[N+]([O-])=O)NC(OC(C)(C)C)=O | | CAS DataBase Reference | 2188-18-3(CAS DataBase Reference) | | EPA Substance Registry System | L-Ornithine, N2-[(1,1-dimethylethoxy)carbonyl]-N5-[imino(nitroamino)methyl]- (2188-18-3) |
| | N-Boc-N'-nitro-L-arginine Usage And Synthesis |
| Uses | Boc-L-Nitroarginine, can be used in peptide chemistry. It has been also shown to act as NO synthase inhibitor, and thus used in the study of The effects of methylene blue (MB) for treatment of sepsis induced by bowel perforation. |
| | N-Boc-N'-nitro-L-arginine Preparation Products And Raw materials |
|