|
| | Ethyl 2-chloropyrimidine-5-carboxylate Basic information |
| Product Name: | Ethyl 2-chloropyrimidine-5-carboxylate | | Synonyms: | ETHYL2-CHLOROPYRIMI;Ethyl 2-chloropyrimidine-5-carboxylate ,97%;2-chloro-pyrimidine-5-carboxylic acid ethyl ester;2-Chloro-5-(ethoxycarbonyl)pyrimidine;5-PyriMidinecarboxylic acid, 2-chloro-, ethyl ester;ETHYL 2-CHLOROPYRIMIDINE-5-CARBOXYLATE;PyriMidin-5-carboxylic acid 2-chloro-, ethyl ester;2-Chloro-5-(ethoxycarbonyl)pyrimidine, 2-Chloro-5-(ethoxycarbonyl)-1,3-diazine | | CAS: | 89793-12-4 | | MF: | C7H7ClN2O2 | | MW: | 186.6 | | EINECS: | | | Product Categories: | Heterocycle-Pyrimidine series | | Mol File: | 89793-12-4.mol |  |
| | Ethyl 2-chloropyrimidine-5-carboxylate Chemical Properties |
| Melting point | 52-60℃ | | Boiling point | 80℃/760mm | | density | 1.311±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Methanol | | form | Solid | | pka | -3.05±0.22(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C7H7ClN2O2/c1-2-12-6(11)5-3-9-7(8)10-4-5/h3-4H,2H2,1H3 | | InChIKey | IEMKQRSOAOPKRJ-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(C(OCC)=O)C=N1 | | CAS DataBase Reference | 89793-12-4 |
| Risk Statements | 20/21/22 | | Safety Statements | 36/37 | | HazardClass | IRRITANT | | HS Code | 29339900 |
| | Ethyl 2-chloropyrimidine-5-carboxylate Usage And Synthesis |
| Chemical Properties | White to light yellow liquid | | Uses | Ethyl 2-chloropyrimidine-5-carboxylate is used in the synthesis of Retinoid x receptor agonists (RXR) that are used in the treatment of cancers. |
| | Ethyl 2-chloropyrimidine-5-carboxylate Preparation Products And Raw materials |
|