|
| | 16-HYDROXYHEXADECANOIC ACID Basic information |
| | 16-HYDROXYHEXADECANOIC ACID Chemical Properties |
| Melting point | 94-98 °C(lit.) | | Boiling point | 414.4±18.0 °C(Predicted) | | density | 0.956±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMF: 20 mg/ml; DMSO: 20 mg/ml; DMSO:PBS(pH 7.2) (1:2): 0.33 mg/ml; Ethanol: 2.5 mg/ml | | pka | 4.78±0.10(Predicted) | | form | Crystalline Powder | | color | White | | BRN | 1783998 | | InChI | InChI=1S/C16H32O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h17H,1-15H2,(H,18,19) | | InChIKey | UGAGPNKCDRTDHP-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCCCCCCCCCCCO | | LogP | 4.904 (est) | | CAS DataBase Reference | 506-13-8(CAS DataBase Reference) | | EPA Substance Registry System | 16-Hydroxypalmitic acid (506-13-8) |
| Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | Yes | | HS Code | 29181998 |
| | 16-HYDROXYHEXADECANOIC ACID Usage And Synthesis |
| Description | 16-hydroxy Hexadecanoic acid is a metabolite of the saturated fatty acid palmitic acid (16:0) that has been hydroxylated on its terminal (ω) carbon. It is produced by ω-hydroxylation of palmitic acid by cytochrome P450 in both plants and animals. In plants, it is commonly a component of cutin. | | Chemical Properties | white crystalline powder | | Uses | 16-Hydroxyhexadecanoic acid was used in the synthesis of dihydroxypalmitic acids. It was also used to induce the expression of two GRP genes of Arabidopsis thaliana, AtGRP5 and AtGRP23. | | Definition | ChEBI: A C16 omega-hydroxy fatty acid and key monomer of cutin in the plant cuticle. |
| | 16-HYDROXYHEXADECANOIC ACID Preparation Products And Raw materials |
| Raw materials | 2H-Pyran, 2-[(15-bromo-2-pentadecyn-1-yl)oxy]tetrahydro--->10,12-Hexadecadiynoic acid, 16-hydroxy--->9-Hexadecenoic acid, 16-hydroxy-, (9Z)--->IHDA-->10-UNDECYNOIC ACID-->Undecanoic acid,10,11-dibromo--->1,12-Dibromododecane | | Preparation Products | 2-Hexanone, 4-hydroxy- (6CI,9CI)-->Hexadecanoic acid, 16-amino--->16-HEXADECANOLIDE-->1,16-HEXADECANEDIOL |
|
