|
| | Diphenylphosphine oxide Basic information |
| | Diphenylphosphine oxide Chemical Properties |
| Melting point | 56-57 °C(lit.) | | Boiling point | 102-105°C 0,2mm | | refractive index | 1.608-1.61 | | storage temp. | Inert atmosphere,Room Temperature | | form | Crystals | | color | Yellow to light orange | | Water Solubility | Slightly soluble in water. | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C12H11OP/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H | | InChIKey | ASUOLLHGALPRFK-UHFFFAOYSA-N | | SMILES | P(=O)(C1=CC=CC=C1)C1=CC=CC=C1 | | CAS DataBase Reference | 4559-70-0(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 2 | | HS Code | 29319090 |
| | Diphenylphosphine oxide Usage And Synthesis |
| Chemical Properties | Yellow to light orange crystals | | Uses | Used in the preparation of triarylphosphine oxides, and as asymmetric catalysts, preparation of alkenyldiphenylphosphine oxides, and Horner-Wittig reagents. It is a ligand for Buchwald-Hartwig Cross Coupling Reaction, Hydrophosphonylations and Suzuki-Miyaura Coupling. | | Uses | suzuki reaction | | Definition | ChEBI: Diphenylphosphine oxide is a member of benzenes. | | Synthesis Reference(s) | Journal of the American Chemical Society, 45, p. 165, 1923 DOI: 10.1021/ja01654a024 |
| | Diphenylphosphine oxide Preparation Products And Raw materials |
|
