|
| | Allyl cyclohexyloxyacetate Basic information |
| Product Name: | Allyl cyclohexyloxyacetate | | Synonyms: | allyl cyclohexyloxyacetate;galbanum oxyacetate;Cyclohexyloxyacetic acid 2-propenyl ester;CYCLOGALBANATE;(cyclohexyloxy)-aceticaci2-propenylester;Aceticacid,(cyclohexyloxy)-,2-propenylester;Allyl cyclohexoylacetate;Allyl-(cyclohexyloxy)acetat | | CAS: | 68901-15-5 | | MF: | C11H18O3 | | MW: | 198.26 | | EINECS: | 272-657-3 | | Product Categories: | ester series | | Mol File: | 68901-15-5.mol |  |
| | Allyl cyclohexyloxyacetate Chemical Properties |
| Boiling point | 283°C | | density | 1.016 | | vapor pressure | 67Pa at 25℃ | | refractive index | 1.460-1.464 | | Fp | >100°C | | Odor | at 10.00 % in dipropylene glycol. green herbal galbanum fruity pineapple leafy spicy woody | | Odor Type | green | | Water Solubility | 1.655g/L at 20℃ | | InChI | InChI=1S/C11H18O3/c1-2-8-13-11(12)9-14-10-6-4-3-5-7-10/h2,10H,1,3-9H2 | | InChIKey | MBUYSYKXSMTIPP-UHFFFAOYSA-N | | SMILES | C(OCC=C)(=O)COC1CCCCC1 | | LogP | 2.8 at 24.7℃ | | EPA Substance Registry System | Acetic acid, (cyclohexyloxy)-, 2-propenyl ester (68901-15-5) |
| | Allyl cyclohexyloxyacetate Usage And Synthesis |
| Chemical Properties | Allyl cyclohexyloxyacetate is a colorless to pale yellowish
liquid with a strong, fruity, herbal, green odor reminiscent of galbanum.
It is prepared by esterification of cyclohexyloxyacetic acid (from phenoxyacetic
acid) with allyl alcohol and is used in fragrance compositions for toiletries and
household products. | | Flammability and Explosibility | Notclassified | | Trade name | Cyclogalbanat® (Symrise) |
| | Allyl cyclohexyloxyacetate Preparation Products And Raw materials |
|
