|
| | Dihydrocaffeic acid Basic information |
| Product Name: | Dihydrocaffeic acid | | Synonyms: | 3-(3,4-dihydroxyphenyl)propanoate;3-(3,4-Dihydroxyphenyl)propionic acid, Hydrocaffeic acid;3-(3,4-Dihydroxyphenyl)propionic acid, 98+%;DIHYDROCAFFEIC ACID(RG);3-(3,4-DIHYDROXYPHENYL)PROPIONIC ACID;3,4-DIHYDROXYHYDROCINNAMIC ACID;3,4-DIHYDROCAFFEIC ACID;BETA-(3,4-DIHYDROXYPHENYL) PROPIONIC ACID | | CAS: | 1078-61-1 | | MF: | C9H10O4 | | MW: | 182.17 | | EINECS: | 214-083-8 | | Product Categories: | Aromatics, Metabolites & Impurities, Pharmaceuticals, Intermediates & Fine Chemicals;Aromatic Cinnamic Acids, Esters and Derivatives | | Mol File: | 1078-61-1.mol |  |
| | Dihydrocaffeic acid Chemical Properties |
| Melting point | 136-139 °C(lit.) | | Boiling point | 418℃ | | density | 1.398 | | Fp | 220℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 4.75±0.10(Predicted) | | form | Solid | | color | Pale Beige to Pale Brown | | Water Solubility | Slightly soluble in water. | | BRN | 2213449 | | InChI | InChI=1S/C9H10O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5,10-11H,2,4H2,(H,12,13) | | InChIKey | DZAUWHJDUNRCTF-UHFFFAOYSA-N | | SMILES | C1(CCC(O)=O)=CC=C(O)C(O)=C1 | | LogP | 0.115 (est) | | CAS DataBase Reference | 1078-61-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | MW5143500 |
| | Dihydrocaffeic acid Usage And Synthesis |
| Description | Dihydrocaffeic acid is a polyphenol that has diverse biological activities, including antioxidant, neuroprotective, and enzyme inhibitory properties. Dihydrocaffeic acid scavenges ABTS (; IC50 = 81.86 μg/ml) and 2,2-diphenyl-1-picrylhydrazyl (DPPH; ; IC50 = 192.86 μg/ml) radicals and increases the survival of RGC-5 mouse retinal ganglion cells under hypoxic conditions and in the presence of S-nitroso-N-acetyl-D,L-penicillamine (SNAP; ) in a concentration-dependent manner. It also decreases endothelial nitric oxide synthase (eNOS) activity in EA.hy926 human endothelial cells in a concentration-dependent manner. In vivo, dihydrocaffeic acid (30 mg/kg) decreases infarct size in a rat model of transient ischemia induced by middle cerebral artery occlusion (MCAO). | | Chemical Properties | Brown Solid | | Uses | Dihydrocaffeic Acid is a natural product containing a catechol group with an α,β-unsaturated carboxylic acid chain. Dihydrocaffeic Acid has been shown to have hepatoprotective activity. Dihydrocaffei
c Acid is a metabolite of Caffeic Acid (C08000) with potent antioxidant properties. | | Uses | 3-(3,4-Dihydroxyphenyl)propionic acid it can be used to produce 3-(3,4-dihydroxy-phenyl)-propionic acid octyl ester by heating. | | Definition | ChEBI: A monocarboxylic acid that is 3-phenylpropionic acid substituted by hydroxy groups at positions 3 and 4. It is a metabolite of caffeic acid and exhibits antioxidant activity. |
| | Dihydrocaffeic acid Preparation Products And Raw materials |
|
