|
| | 4-tert-Butylphenylboronic acid Basic information |
| | 4-tert-Butylphenylboronic acid Chemical Properties |
| Melting point | 191-196 °C (lit.) | | Boiling point | 296.7±33.0 °C(Predicted) | | density | 1.02±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Crystalline Powder | | pka | 8.79±0.10(Predicted) | | color | White to off-white | | BRN | 5330959 | | InChI | InChI=1S/C10H15BO2/c1-10(2,3)8-4-6-9(7-5-8)11(12)13/h4-7,12-13H,1-3H3 | | InChIKey | MNJYZNVROSZZQC-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(C(C)(C)C)C=C1)(O)O | | CAS DataBase Reference | 123324-71-0(CAS DataBase Reference) |
| | 4-tert-Butylphenylboronic acid Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder | | Uses | suzuki reaction | | Uses | 4-t-Butylphenylboronic acid is a cross-coupling building block used in the preparation of tetracyclnes and tetracycline derivatives. | | Uses | Cross-coupling building block used in synthesis of tetracycline derivatives. |
| | 4-tert-Butylphenylboronic acid Preparation Products And Raw materials |
|