|
| | 3-Methyl-3-oxetanemethanol Basic information |
| | 3-Methyl-3-oxetanemethanol Chemical Properties |
| Boiling point | 80 °C/40 mmHg (lit.) | | density | 1.024 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.446(lit.) | | Fp | 210 °F | | storage temp. | 2-8°C | | solubility | Soluble in chloroform, methanol. | | pka | 14.58±0.10(Predicted) | | form | Liquid | | color | Clear colorless to pale yellow | | Specific Gravity | 1.024 | | BRN | 102773 | | InChI | InChI=1S/C5H10O2/c1-5(2-6)3-7-4-5/h6H,2-4H2,1H3 | | InChIKey | NLQMSBJFLQPLIJ-UHFFFAOYSA-N | | SMILES | O1CC(C)(CO)C1 | | CAS DataBase Reference | 3143-02-0(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Methyl-3-oxetanemethanol(3143-02-0) |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 23-24/25-36/37 | | WGK Germany | 3 | | HS Code | 29329990 |
| | 3-Methyl-3-oxetanemethanol Usage And Synthesis |
| Chemical Properties | Clear colorless to pale yellow liquid | | Uses | 3-Methyl-3-oxetanemethanol has been used in the preparation of star-shaped copolymer consisting of a hyperbranched poly(3-methyl-3-oxetanemethanol) core and polytetrahydrofuran arms, pyridyl disulfide-functionalized cyclic carbonate monomer, required for the synthesis of of functional poly(ε-caprolactone) containing pendant pyridyl disulphide groups and δ-lactams. It is used to synthesize octahydroindole alkaloids and γ-butenolides. | | Definition | ChEBI: (3-Methyl-3-oxetanyl)methanol is a 2,2-dimethyl-2,3-dihydro-1-benzofuran-7-ol. | | Synthesis Reference(s) | Tetrahedron Letters, 24, p. 5571, 1983 DOI: 10.1016/S0040-4039(00)94143-1 | | Purification Methods | Purify the oxetane by fractionation through a glass column [Pattison J Am Chem Soc 79 3455 1957, Corey et al. J Am Chem Soc 106 2736 1984]. [Beilstein 17 III/IV 1128.] |
| | 3-Methyl-3-oxetanemethanol Preparation Products And Raw materials |
|
