| 
 |  | 4-(3-AMINO-1,2,4-TRIAZIN-6-YL)-2-FLUOROBENZONITRILE Basic information |  
  
 |  | 4-(3-AMINO-1,2,4-TRIAZIN-6-YL)-2-FLUOROBENZONITRILE Chemical Properties |  
 | Boiling point  | 497.4±55.0 °C(Predicted) |  | density  | 1.46±0.1 g/cm3 (20 ºC 760 Torr) |  | pka | 2?+-.0.63(Predicted) |  | InChI | InChI=1S/C10H6FN5/c11-8-3-6(1-2-7(8)4-12)9-5-14-10(13)16-15-9/h1-3,5H,(H2,13,14,16) |  | InChIKey | JXQHTMHBDHVPDQ-UHFFFAOYSA-N |  | SMILES | C(#N)C1=CC=C(C2N=NC(N)=NC=2)C=C1F |  
  
 |  | 4-(3-AMINO-1,2,4-TRIAZIN-6-YL)-2-FLUOROBENZONITRILE Usage And Synthesis |  
 | Uses | 4-(3-Amino-1,2,4-triazin-6-yl)-2-fluorobenzonitrile is a useful research chemical compound used in the preparation of salts of [(quinolinylmethyl)imidazotriazinyl]benzamide as tyrosine kinase inhibitors useful in the treatment of diseases. |  
  
 |  | 4-(3-AMINO-1,2,4-TRIAZIN-6-YL)-2-FLUOROBENZONITRILE Preparation Products And Raw materials |  
  
 
 |