|
| | 5-Formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid Basic information |
| | 5-Formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid Chemical Properties |
| Melting point | 283°C(lit.) | | Boiling point | 374.9±42.0 °C(Predicted) | | density | 1.342±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Aqueous Base (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 5.56±0.50(Predicted) | | color | Beige | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C8H9NO3/c1-4-6(3-10)9-5(2)7(4)8(11)12/h3,9H,1-2H3,(H,11,12) | | InChIKey | YCIHQDVIAISDPS-UHFFFAOYSA-N | | SMILES | N1C(C=O)=C(C)C(C(O)=O)=C1C | | CAS DataBase Reference | 253870-02-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | HS Code | 2933998090 |
| | 5-Formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid Usage And Synthesis |
| Description | 5-Formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid is an important organic intermediate to synthetize substituted pyrrole products. | | Uses | 5-Formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic Acid is useful for the synthesis of 5-Bromo-7-azaindolin-2-one derivatives which possesses in vitro activity against selected cancer cell lines. | | Uses | 5-Formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid is a yellow crystalline substance, mainly used as pharmaceutical intermediates. |
| | 5-Formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid Preparation Products And Raw materials |
|
