| 
 |  | 2-(3,4-DIFLUOROPHENYL)-1,3-DIOXOLANE Basic information |  
 | Product Name: | 2-(3,4-DIFLUOROPHENYL)-1,3-DIOXOLANE |  | Synonyms: | 2-(3,4-DIFLUOROPHENYL)-1,3-DIOXOLANE;RARECHEM AL BP 0215;1,3-Dioxolane, 2-(3,4-difluorophenyl)-;2-(3,4-Difluorophenyl)-1,3-dioxolane,98% |  | CAS: | 773101-62-5 |  | MF: | C9H8F2O2 |  | MW: | 186.16 |  | EINECS: |  |  | Product Categories: |  |  | Mol File: | 773101-62-5.mol |    |  
  
 |  | 2-(3,4-DIFLUOROPHENYL)-1,3-DIOXOLANE Chemical Properties |  
 | Boiling point  | 228.1±40.0 °C(Predicted) |  | density  | 1.298±0.06 g/cm3(Predicted) |  | InChI | InChI=1S/C9H8F2O2/c10-7-2-1-6(5-8(7)11)9-12-3-4-13-9/h1-2,5,9H,3-4H2 |  | InChIKey | JDIKHNSLOQHKLX-UHFFFAOYSA-N |  | SMILES | O1CCOC1C1=CC=C(F)C(F)=C1 |  | CAS DataBase Reference | 773101-62-5 |  
  
 |  | 2-(3,4-DIFLUOROPHENYL)-1,3-DIOXOLANE Usage And Synthesis |  
 | Uses | 2-(3,4-difluorophenyl)-1,3-dioxolane is an organofluorine compound and is used as an organic reagent. |  
  
 |  | 2-(3,4-DIFLUOROPHENYL)-1,3-DIOXOLANE Preparation Products And Raw materials |  
  |