|
| | 1-Propanone, 2-chloro-1-(4-methylphenyl)- (9CI) Basic information |
| Product Name: | 1-Propanone, 2-chloro-1-(4-methylphenyl)- (9CI) | | Synonyms: | 1-Propanone, 2-chloro-1-(4-methylphenyl)- (9CI);1-Propanone, 2-chloro-1-(4-Methylphenyl)-;2-Chloro-1-(4-Methylphenyl)-1-propanone;Loxoprofen Impurity 17;(2R)-2-chloro-1-(4-methylphenyl)propan-1-one;Loxoprofen Impurity 88;2-chloro-1 - (4-methylphenyl) - 1-acetone;2-Chloro-1-(4-Methylphenyl)-1-Propanone (9CI) | | CAS: | 69673-92-3 | | MF: | C10H11ClO | | MW: | 182.65 | | EINECS: | 237-344-8 | | Product Categories: | ACETYLHALIDE;69673-92-3 | | Mol File: | 69673-92-3.mol |  |
| | 1-Propanone, 2-chloro-1-(4-methylphenyl)- (9CI) Chemical Properties |
| Boiling point | 92 °C(Press: 2 Torr) | | density | 1.103±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C10H11ClO/c1-7-3-5-9(6-4-7)10(12)8(2)11/h3-6,8H,1-2H3 | | InChIKey | AVMPEHALQVCQQQ-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(C)C=C1)(=O)C(Cl)C |
| | 1-Propanone, 2-chloro-1-(4-methylphenyl)- (9CI) Usage And Synthesis |
| Chemical Properties | Brown Crystal powder. | | Uses | 2-Chloro-1-(4-methylphenyl)-1-propanone is an intermediate for the synthesis of Mephedrone Hydrochloride (M224200), which is a stimulant drug related to cathinone and methcathinone. The effects of Mephedrone are reportedly comparable to those of similar drugs such as MDMA and methylone. |
| | 1-Propanone, 2-chloro-1-(4-methylphenyl)- (9CI) Preparation Products And Raw materials |
|
