|
| | Flubrotizolam Basic information |
| Product Name: | Flubrotizolam | | Synonyms: | 6H-Thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine, 2-bromo-4-(2-fluorophenyl)-9-methyl-;flubrotizolam;2-bromo-4-(2-fluorophenyl)-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine;Flubrotizolam Powder;Flubrotizolam Raw Powder;2-bromo-4-(2-fluorophenyl)-9-methyl-6H-thieno[3,2-f];fiubrotizolam | | CAS: | 57801-95-3 | | MF: | C15H10BrFN4S | | MW: | 377.23 | | EINECS: | 200-284-8 | | Product Categories: | Pharm;57801-95-3 | | Mol File: | 57801-95-3.mol |  |
| | Flubrotizolam Chemical Properties |
| Boiling point | 535.7±60.0 °C(Predicted) | | density | 1.76±0.1 g/cm3(Predicted) | | solubility | DMF:5.0(Max Conc. mg/mL);13.0(Max Conc. mM)
DMSO:5.0(Max Conc. mg/mL);13.0(Max Conc. mM)
DMSO:PBS (pH 7.2) (1:1):0.5(Max Conc. mg/mL);1.3(Max Conc. mM) | | pka | 1.98±0.40(Predicted) | | form | A crystalline solid | | InChI | InChI=1S/C15H10BrFN4S/c1-8-19-20-13-7-18-14(9-4-2-3-5-11(9)17)10-6-12(16)22-15(10)21(8)13/h2-6H,7H2,1H3 | | InChIKey | VOZDBDBHBXLWCG-UHFFFAOYSA-N | | SMILES | N12C(C)=NN=C1CN=C(C1=CC=CC=C1F)C1C=C(Br)SC=12 |
| | Flubrotizolam Usage And Synthesis |
| Description | Flubrotizolam is an analytical reference standard categorized as a thienodiazepine. This product is intended for research and forensic applications. | | Uses | Flubrotizolam is a thienotriazolodiazepine derivative with potent sedative and anxiolytic effects, which has been sold as a designer drug. | | Health effects | Flubrotizolam is a synthetic benzodiazepine derivative that has sedative, anxiolytic, and muscle relaxant properties. It is a potent agonist at the GABA-A receptor, which is the same receptor targeted by other benzodiazepines like Valium and Xanax. Flubrotizolam has not been approved for medical use and is considered a designer drug. It has been reported to be sold on the illicit drug market and can pose significant health risks due to its potency and potential for abuse. |
| | Flubrotizolam Preparation Products And Raw materials |
|
