|
| | 1,1,1,2,3,4,4,5,5,5,-Decafluoro-3-methoxy-2-(trifloromethyl)pentane Basic information |
| Product Name: | 1,1,1,2,3,4,4,5,5,5,-Decafluoro-3-methoxy-2-(trifloromethyl)pentane | | Synonyms: | 3-METHOXYPERFLUORO(2-METHYLPENTANE);1,1,1,2,3,4,4,5,5,5-DECAFLUORO-3-METHOXY-2-(TRIFLUOROMETHYL)PENTANE;1,1,1,2,3,4,4,5,5,5-Decafluoro-3-methoxy-2-methylpentane;3-METHOXYPERFLUORO(2-METHYLPENTANE), 98% MIN.;1,1,1,2,3,4,4,5,5,5,-Decafluoro-3-methoxy-2-(trifloromethyl)pentane;Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-;HFE 7300;Decafluoro-3-methoxy-4-(trifluoromethyl)pentane(NOVEC 7300) | | CAS: | 132182-92-4 | | MF: | C7H3F13O | | MW: | 350.08 | | EINECS: | 459-520-5 | | Product Categories: | | | Mol File: | 132182-92-4.mol |  |
| | 1,1,1,2,3,4,4,5,5,5,-Decafluoro-3-methoxy-2-(trifloromethyl)pentane Chemical Properties |
| Boiling point | 100 °C | | density | 1.67 | | vapor pressure | 62.5hPa at 20℃ | | Water Solubility | Insoluble in water | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C7H3F13O/c1-21-4(11,3(9,10)7(18,19)20)2(8,5(12,13)14)6(15,16)17/h1H3 | | InChIKey | QKAGYSDHEJITFV-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C(F)(F)C(F)(OC)C(F)(C(F)(F)F)C(F)(F)F | | LogP | 4.3 at 23.4℃ | | CAS DataBase Reference | 132182-92-4 | | EPA Substance Registry System | Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)- (132182-92-4) |
| | 1,1,1,2,3,4,4,5,5,5,-Decafluoro-3-methoxy-2-(trifloromethyl)pentane Usage And Synthesis |
| Uses | 1,1,1,2,2,3,4,5,5,5-Decafluoro-3-methoxy-4-(trifluoromethyl)pentane is used in preparation method of isolated Hydrofluoroether. |
| | 1,1,1,2,3,4,4,5,5,5,-Decafluoro-3-methoxy-2-(trifloromethyl)pentane Preparation Products And Raw materials |
|
