|
| | 2-(3,4-Epoxycyclohexyl)ethyltriethoxysilane Basic information |
| Product Name: | 2-(3,4-Epoxycyclohexyl)ethyltriethoxysilane | | Synonyms: | 2-(3,4-EPOXYCYCLOHEXYL)ETHYLTRIETHOXYSILANE;triethoxy[2-(7-oxabicyclo[4.1.0]hept-3-yl)ethyl]-Silane;Silane, triethoxy2-(7-oxabicyclo4.1.0hept-3-yl)ethyl-;BETA-(3,4-EPOXYCYCLOHEXYL)ETHYLTRIETHOXYSILANE;triethoxy-[2-(7-oxabicyclo[4.1.0]heptan-4-yl)ethyl]silane;Triethoxy-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane;(2-(7-Oxabicyclo[4.1.0]heptan-3-yl)ethyl)triethoxysilane;7-Oxabicyclo[4.1.0]heptane, 3-[2-(triethoxysilyl)ethyl]- | | CAS: | 10217-34-2 | | MF: | C14H28O4Si | | MW: | 288.46 | | EINECS: | 425-050-4 | | Product Categories: | silane | | Mol File: | 10217-34-2.mol |  |
| | 2-(3,4-Epoxycyclohexyl)ethyltriethoxysilane Chemical Properties |
| Boiling point | 114-117°C 0,4mm | | density | 1,015 g/cm3 | | vapor pressure | 0.3Pa at 20℃ | | refractive index | 1.4455 | | Fp | 104°C | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.015 | | Water Solubility | 850mg/L at 20℃ | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C14H28O4Si/c1-4-15-19(16-5-2,17-6-3)10-9-12-7-8-13-14(11-12)18-13/h12-14H,4-11H2,1-3H3 | | InChIKey | UDUKMRHNZZLJRB-UHFFFAOYSA-N | | SMILES | C12C(O1)CCC(CC[Si](OCC)(OCC)OCC)C2 | | LogP | 4.6 at 23℃ | | CAS DataBase Reference | 10217-34-2 | | EPA Substance Registry System | Silane, triethoxy[2-(7-oxabicyclo[4.1.0]hept-3-yl)ethyl]- (10217-34-2) |
| | 2-(3,4-Epoxycyclohexyl)ethyltriethoxysilane Usage And Synthesis |
| Flammability and Explosibility | Nonflammable |
| | 2-(3,4-Epoxycyclohexyl)ethyltriethoxysilane Preparation Products And Raw materials |
|
