|
| | 3,5-Bis(trifluoromethyl)benzoic acid Basic information |
| Product Name: | 3,5-Bis(trifluoromethyl)benzoic acid | | Synonyms: | 3, 5-Bis (trifluoromrthyl) benzoic acid;3,5-BIS(TRIFLUOROMETHYL)BENZOIC ACID, 98 %;3,5-Di-(Trifluoromethyl)Benzoi;3,5-Di(trifluoromethyl)benzoic acid , TECH;3,5-Bis(trifluoroMethyl)benzoic acid, 98% 5GR;3,5-Di(trifluoroMethyl)benzoic acid, 90, TECH;3,5-bis(trifluoromethyl)-benzoicaci;3,5-BIS(TRIFLUOROMETHYL)BENZOIC ACID | | CAS: | 725-89-3 | | MF: | C9H4F6O2 | | MW: | 258.12 | | EINECS: | 211-970-1 | | Product Categories: | Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Benzoic acid;Miscellaneous;Benzotrifluoride Series;Boronic Acid series;Fluorobenzene;Fluorides;C9;Carbonyl Compounds;Carboxylic Acids | | Mol File: | 725-89-3.mol |  |
| | 3,5-Bis(trifluoromethyl)benzoic acid Chemical Properties |
| Melting point | 142-143 °C(lit.) | | Boiling point | 223.9±40.0 °C(Predicted) | | density | 1,42 g/cm3 | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO, Methanol | | form | Solid | | pka | 3.34±0.10(Predicted) | | color | White to Off-White | | Water Solubility | Slightly soluble in water. | | BRN | 2058600 | | InChI | InChI=1S/C9H4F6O2/c10-8(11,12)5-1-4(7(16)17)2-6(3-5)9(13,14)15/h1-3H,(H,16,17) | | InChIKey | HVFQJWGYVXKLTE-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 | | CAS DataBase Reference | 725-89-3(CAS DataBase Reference) | | NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)benzoic acid(725-89-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | RTECS | DG4448020 | | HazardClass | IRRITANT | | HS Code | 29163990 |
| | 3,5-Bis(trifluoromethyl)benzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 3,5-Bis(trifluoromethyl)benzoic acid is a useful synthetic intermediate, and is a derivative of Benzoic acid (B203900). 3,5-Bis(trifluoromethyl)benzoic acid has also been identified as a major metabolite of a series of 3,5-bis(trifluoromethyl)benzyl ethers in vitro, and is hypothesized to result via oxidation of the benzylic position. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 68, p. 3695, 2003 DOI: 10.1021/jo026903n | | General Description | 3,5-Bis(trifluoromethyl)benzoic acid is a significant metabolite formed during metabolism of 3,5-bis(trifluoromethyl)benzyl ether via oxidation. |
| | 3,5-Bis(trifluoromethyl)benzoic acid Preparation Products And Raw materials |
| Raw materials | 3,5-BIS(TRIFLUOROMETHYL)STYRENE-->1,3,5-Tris(trifluoromethyl)benzene-->3,5-BIS(TRIFLUOROMETHYL)IODOBENZENE-->Benzoyl fluoride, 3,5-bis(trifluoromethyl)--->1,3-Bis(trifluoromethyl)-benzene-->3,5-Bis(trifluoromethyl)benzoyl chloride-->carbon monoxide-->CARBON DIOXIDE-->3,5-Bis(trifluoromethyl)bromobenzene | | Preparation Products | 3,5-Bis(trifluoromethyl)phenylacetonitrile-->3,5-Bis(trifluoromethyl)benzaldehyde-->2,4-BIS(TRIFLUOROMETHYL)BENZOIC ACID |
|
