|  | |  |  | 1,2,3,5-Tetrafluorobenzene Basic information | 
 | Product Name: | 1,2,3,5-Tetrafluorobenzene |  | Synonyms: | 1,2,3,5-TETRAFLUOROBENZENE;4-flurobenzalcohol;1,2,3,5-Tetrafluorobenzene 97%;1,2,3,5-Tetrafluorobenzene97%;1,2,3,5-TETRAFLUOROBENZENE 99+%;1,2,4,6-Tetrafluorobenzene;1,3,4,5-Tetrafluorobenzene;benzene,1,2,3,5-tetrafluoro- |  | CAS: | 2367-82-0 |  | MF: | C6H2F4 |  | MW: | 150.07 |  | EINECS: | 219-126-4 |  | Product Categories: | Fluorobenzene;Aryl;C6;Halogenated  Hydrocarbons |  | Mol File: | 2367-82-0.mol |  |  | 
|  |  | 1,2,3,5-Tetrafluorobenzene Chemical Properties | 
 | Melting point | -48 °C |  | Boiling point | 83 °C(lit.) |  | density | 1.393 g/mL at 25 °C(lit.) |  | refractive index | n20/D 1.404(lit.) |  | Fp | 40 °F |  | storage temp. | Refrigerator |  | form | clear liquid |  | color | Colorless to Almost colorless |  | Water Solubility | 743.1mg/L(25 ºC) |  | InChI | InChI=1S/C6H2F4/c7-3-1-4(8)6(10)5(9)2-3/h1-2H |  | InChIKey | UHHYOKRQTQBKSB-UHFFFAOYSA-N |  | SMILES | C1(F)=CC(F)=CC(F)=C1F |  | CAS DataBase Reference | 2367-82-0(CAS DataBase Reference) |  | NIST Chemistry Reference | Benzene, 1,2,3,5-tetrafluoro-(2367-82-0) | 
| Hazard Codes | F,Xi |  | Risk Statements | 11-36/37/38 |  | Safety Statements | 16-26-7-33-29-7/9 |  | RIDADR | UN 1993 3/PG 2 |  | WGK Germany | 3 |  | Hazard Note | Flammable/Irritant |  | HazardClass | 3.1 |  | PackingGroup | II |  | HS Code | 29039990 | 
|  |  | 1,2,3,5-Tetrafluorobenzene Usage And Synthesis | 
 | Chemical Properties | clear colorless liquid |  | Uses | Intermediates of pharmaceuticals, pesticides, and liquid crystal materials. |  | General Description | The crystal structure of 1,2,3,5-tetrafluorobenzene was studied. The nuclear magnetic resonance spectrum (1H and 19F) of 1,2,3,5-tetrafluorobenzene was studied. | 
|  |  | 1,2,3,5-Tetrafluorobenzene Preparation Products And Raw materials | 
 | Raw materials | 1,3-Cyclohexadiene, 1,2,3,5,5,6,6-heptafluoro--->2,3,4,6-TETRAFLUOROBENZENEBORONIC ACID-->1,3-Diiodotetrafluorobenzene-->Benzene, 1,2,3,5-tetrafluoro-4-iodo--->1-bromo-2,3,4,6-tetrafluorobenzene-->1,4-Cyclohexadiene, 1,3,3,5,6,6-hexafluoro--->2,3,5-TRIFLUOROANILINE-->1,3-DIBROMOTETRAFLUOROBENZENE-->1,3,5-Trifluoro-2-nitrobenzene-->Water-->Chlorotrimethylsilane |  | Preparation Products | 1-bromo-2,3,4,6-tetrafluorobenzene-->1,2,3,4-Tetrafluorobenzene-->1,2,4,5-Tetrafluorobenzene-->3,4,5-Trifluoroaniline | 
 |