|
| | 1,1-Cyclopropanedicarboxylic acid Basic information |
| | 1,1-Cyclopropanedicarboxylic acid Chemical Properties |
| Melting point | 134-136 °C(lit.) | | Boiling point | 200.75°C (rough estimate) | | density | 1.3985 (rough estimate) | | refractive index | 1.5800 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | methanol: soluble1g/10 mL, clear, colorless | | pka | 1.82(at 25℃) | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Soluble | | BRN | 1864823 | | InChI | InChI=1S/C5H6O4/c6-3(7)5(1-2-5)4(8)9/h1-2H2,(H,6,7)(H,8,9) | | InChIKey | FDKLLWKMYAMLIF-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)(C(O)=O)CC1 | | CAS DataBase Reference | 598-10-7(CAS DataBase Reference) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38-34 | | Safety Statements | 26-36-45-36/37/39 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29172090 |
| | 1,1-Cyclopropanedicarboxylic acid Usage And Synthesis |
| Chemical Properties | white to almost white crystalline powder | | Uses | 1,1-Cyclopropanedicarboxylic acid, is used as an inhibitor of 1-aminocyclopropane-1-carboxylic acid oxidase, was quantitated in Lycopersicum esculentum by HPLC-electrospray tandem mass spectrometry. Crystal and molecular structure of cyclopropane-1,1-dicarboxylic acid has been reported. Cyclopropane-1,1-dicarboxylic acid was used in the preparation of new heterocyclic derivatives of cyclopropane dicarboxylic acid containing thiadiazole and 1,2,4-triazole moieties. It was also used to prepare spiro-cyclopropyl metallocycles. It can also be used as a building block for the synthesis of a series of cyclopropanecarboxamides, having antifungal activity. | | Uses | 1,1-Cyclopropanedicarboxylic acid is used to prepare spiro-cyclopropyl metallocycles.1
| | General Description | Cyclopropane-1,1-dicarboxylic acid is a dicarboxylic acid. Cyclopropane-1,1-dicarboxylic acid, an inhibitor of 1-aminocyclopropane-1-carboxylic acid oxidase, was quantitated in Lycopersicum esculentum by HPLC-electrospray tandem mass spectrometry. Crystal and molecular structure of cyclopropane-1,1-dicarboxylic acid has been reported. | | Purification Methods | Recrystallise the di-acid from CHCl3, EtOAc or *C6H6/Et2O/pet ether. It forms a monohydrate. [Nicolet & Satler J Am Chem Soc 49 2070 1927, Beilstein 9 II 512, 9 III 3795.] |
| | 1,1-Cyclopropanedicarboxylic acid Preparation Products And Raw materials |
|
