|
| Product Name: | TAPSO | | Synonyms: | 3-[N-Tris-(hydroxyMethyl)MethylaMino]-2-hydroxypropanesulphonic acid(TAPSO);TAPSO(2-Hydroxy-3-[tris(hydroxyMethylaMino]-1 propanesulfonic acid);TAPSO Vetec(TM) reagent grade, >=99%;N-[Tris(hydroxymethyl)metyl]-3-amino-2-hydroxypropanesulfonic acid;Tapso≥ 99.9% (titration);TAPSO Buffer;TAPSO, 99+%, FOR BIOCHEMISTRY;TAPSO, for biochemistry | | CAS: | 68399-81-5 | | MF: | C7H17NO7S | | MW: | 259.28 | | EINECS: | 269-993-8 | | Product Categories: | Buffer;Biochemistry;Good's Buffers | | Mol File: | 68399-81-5.mol |  |
| | TAPSO Chemical Properties |
| Melting point | 224-229 °C (dec.) | | density | 1.07607 g/cm3(Temp: 25.00 °C) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | H2O: 1 M at 20 °C, clear, colorless | | form | Powder | | color | Off-white to yellow | | pka | 7.6(at 25℃) | | PH Range | 7.0 - 8.2 | | Water Solubility | soluble | | Merck | 13,9148 | | BRN | 2113949 | | InChI | InChI=1S/C7H17NO7S/c9-3-7(4-10,5-11)8-1-6(12)2-16(13,14)15/h6,8-12H,1-5H2,(H,13,14,15) | | InChIKey | RZQXOGQSPBYUKH-UHFFFAOYSA-N | | SMILES | C(S(O)(=O)=O)C(O)CNC(CO)(CO)CO | | CAS DataBase Reference | 68399-81-5(CAS DataBase Reference) | | EPA Substance Registry System | 1-Propanesulfonic acid, 2-hydroxy-3-[[2-hydroxy-1,1-bis(hydroxymethyl)ethyl]amino]- (68399-81-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | Yes | | HazardClass | IRRITANT | | HS Code | 29221990 |
| | TAPSO Usage And Synthesis |
| Chemical Properties | white powder | | Uses | TAPSO is a zwitterionic biological buffer often used as a buffering agent in biological and biochemical research. |
| | TAPSO Preparation Products And Raw materials |
|
