|
| | Boc-L-Pyroglutamic acid methyl ester Basic information |
| | Boc-L-Pyroglutamic acid methyl ester Chemical Properties |
| Melting point | 68-72 °C
69-74 °C | | Boiling point | 361.6±35.0 °C(Predicted) | | density | 1.209±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in dichloromethane. | | pka | -4.28±0.40(Predicted) | | form | powder to crystal | | color | White to Almost white | | optical activity | [α]22/D 32.0°, c = 0.5 in chloroform &_& [α]22/D -32°, c = 0.5% in chloroform | | InChI | InChI=1S/C11H17NO5/c1-11(2,3)17-10(15)12-7(9(14)16-4)5-6-8(12)13/h7H,5-6H2,1-4H3/t7-/m0/s1 | | InChIKey | FNTAOUUEQHKLIU-ZETCQYMHSA-N | | SMILES | N1(C(OC(C)(C)C)=O)C(=O)CC[C@H]1C(OC)=O | | CAS DataBase Reference | 108963-96-8(CAS DataBase Reference) |
| Hazard Codes | Xn,N | | Risk Statements | 36-43-50 | | Safety Statements | 26-36/37-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HazardClass | 9 | | HS Code | 29337900 |
| | Boc-L-Pyroglutamic acid methyl ester Usage And Synthesis |
| Chemical Properties | Light Yellow Solid | | Uses | Methyl (S)-1-Boc-5-oxopyrrolidine-2-carboxylate in medicine, pharmacy, cosmetics, and industrial, artificial flavoring and fragrance agents |
| | Boc-L-Pyroglutamic acid methyl ester Preparation Products And Raw materials |
|