|
| | 2-Aminoacetophenone hydrochloride Basic information |
| | 2-Aminoacetophenone hydrochloride Chemical Properties |
| Melting point | 194 °C (dec.)(lit.) | | storage temp. | Refrigerator (+4°C) | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Crystals | | color | Slightly yellow to beige | | BRN | 3563173 | | Stability: | Hygroscopic | | InChI | InChI=1S/C8H9NO.ClH/c9-6-8(10)7-4-2-1-3-5-7;/h1-5H,6,9H2;1H | | InChIKey | CVXGFPPAIUELDV-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(=O)CN.[H]Cl | | CAS DataBase Reference | 5468-37-1(CAS DataBase Reference) | | EPA Substance Registry System | Ethanone, 2-amino-1-phenyl-, hydrochloride (5468-37-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-24/25 | | WGK Germany | 3 | | RTECS | AM5940000 | | TSCA | Yes | | HazardClass | IRRITANT | | HS Code | 29223990 |
| | 2-Aminoacetophenone hydrochloride Usage And Synthesis |
| Chemical Properties | Off-white crystalline | | Uses | Mixed Salt of α-Aminoacetophenone, used in the preparation og pseudopeptidic inhibitors of human sirtuins1-3. This action effectually displays antiproliferative protperties in cancer cells. Also used in the preparation of dual δ/μopiod receptor agonists. | | Purification Methods | Crystallise the salt from Me2CO /EtOH, EtOH/ Et2O, 2-propanol or 2-propanol and a little HCl (slowly after a fe |
| | 2-Aminoacetophenone hydrochloride Preparation Products And Raw materials |
|