|
| | 3,8-Dibromophenanthroline Basic information |
| Product Name: | 3,8-Dibromophenanthroline | | Synonyms: | 3,8-Dibromo-1,10-phenanthroline;3,8-Dibromophenanthroline;3,8-Dibromophenanthr;1,10-Phenanthroline,3,8-dibroMo-;3,8-dibromo-1,7-phenanthroline;3,8-Dibromophenthroline;3,8-dibromopheroline;3,8-Dibromo-1,10-phenanthroline> | | CAS: | 100125-12-0 | | MF: | C12H6Br2N2 | | MW: | 338 | | EINECS: | 1308068-626-2 | | Product Categories: | MOFS COFS | | Mol File: | 100125-12-0.mol |  |
| | 3,8-Dibromophenanthroline Chemical Properties |
| Melting point | 221-222 °C | | Boiling point | 428.9±40.0 °C(Predicted) | | density | 1.915 | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 3.90±0.10(Predicted) | | color | White to Light yellow | | λmax | 352nm(DMF)(lit.) | | InChI | InChI=1S/C12H6Br2N2/c13-9-3-7-1-2-8-4-10(14)6-16-12(8)11(7)15-5-9/h1-6H | | InChIKey | IDWJREBUVYSPKS-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C3C=2N=CC(Br)=C3)C=C(Br)C=1 |
| | 3,8-Dibromophenanthroline Usage And Synthesis |
| | 3,8-Dibromophenanthroline Preparation Products And Raw materials |
|
