|
| | 2-Chloroanthraquinone Basic information |
| | 2-Chloroanthraquinone Chemical Properties |
| Melting point | 209-211 °C (lit.) | | Boiling point | 345.65°C (rough estimate) | | density | 1.2377 (rough estimate) | | refractive index | 1.5380 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light orange to Yellow | | Water Solubility | insoluble | | BRN | 2051842 | | InChI | InChI=1S/C14H7ClO2/c15-8-5-6-11-12(7-8)14(17)10-4-2-1-3-9(10)13(11)16/h1-7H | | InChIKey | FPKCTSIVDAWGFA-UHFFFAOYSA-N | | SMILES | C1=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1Cl | | CAS DataBase Reference | 131-09-9(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Chloroanthraquinone(131-09-9) | | EPA Substance Registry System | 9,10-Anthracenedione, 2-chloro- (131-09-9) |
| | 2-Chloroanthraquinone Usage And Synthesis |
| Chemical Properties | Pale yellow needle crystal. Insoluble in water, soluble in hot benzene, nitrobenzene, concentrated sulfuric acid. | | Uses | 2-Chloroanthraquinone is an important dye intermediate that can be used to make alizarin and aminoanthraquinone. This product has been evaluated as a photo-reagent for the analysis of ginsenosides using photoreduction fluorescence (PRF) detection method. | | Preparation | 2-Chloroanthraquinone is prepared by condensing phthalic anhydride and chlorobenzene into p-chlorobenzoylbenzoic acid, and then cyclizing it with sulfuric acid. | | Synthesis Reference(s) | Tetrahedron Letters, 24, p. 5499, 1983 DOI: 10.1016/S0040-4039(00)94122-4 |
| | 2-Chloroanthraquinone Preparation Products And Raw materials |
|