|
| | 5-Bromo-5-nitro-1,3-dioxane Basic information |
| | 5-Bromo-5-nitro-1,3-dioxane Chemical Properties |
| Melting point | 58-60 °C | | Boiling point | 280.8±40.0 °C(Predicted) | | density | 1.070 | | vapor pressure | 1.6Pa at 20℃ | | refractive index | 1.6200 (estimate) | | storage temp. | 2-8°C | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS(pH 7.2) (1:4): 0.2 mg/ml; Ethanol: 25 mg/ml | | form | neat | | color | White to Almost white | | Water Solubility | Soluble in water at 12.5mg/ml | | InChI | InChI=1S/C4H6BrNO4/c5-4(6(7)8)1-9-3-10-2-4/h1-3H2 | | InChIKey | XVBRCOKDZVQYAY-UHFFFAOYSA-N | | SMILES | O1CC(Br)([N+]([O-])=O)COC1 | | LogP | 1.6 at 23℃ | | CAS DataBase Reference | 30007-47-7(CAS DataBase Reference) | | NIST Chemistry Reference | 1,3-Dioxane, 5-bromo-5-nitro-(30007-47-7) | | EPA Substance Registry System | 1,3-Dioxane, 5-bromo-5-nitro- (30007-47-7) |
| Hazard Codes | Xn | | Risk Statements | 22-38 | | Safety Statements | 36 | | RIDADR | 1759 | | WGK Germany | 3 | | RTECS | JG9650000 | | TSCA | Yes | | HS Code | 29329990 |
| | 5-Bromo-5-nitro-1,3-dioxane Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 5-Bromo-5-nitro-1,3-dioxane is used as a stabilizer and preserving agent for biological molecules and solutions such as antibodies and antisera. Bronidox is used in a variety of rinse-off cosmetic. It can be used alone or in combination with methylisothiazolone. | | General Description | 5-Bromo-5-nitro-1,3-dioxane is a bromine containing preservative commonly used in cosmetic products. | | Flammability and Explosibility | Notclassified |
| | 5-Bromo-5-nitro-1,3-dioxane Preparation Products And Raw materials |
|
