|
| | 1-Bromo-2,5-difluorobenzene Basic information |
| | 1-Bromo-2,5-difluorobenzene Chemical Properties |
| Melting point | −31 °C(lit.) | | Boiling point | 58-59 °C20 mm Hg(lit.) | | density | 1.708 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.508(lit.) | | Fp | 149 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Specific Gravity | 1.708 | | Water Solubility | Insoluble | | BRN | 1680893 | | InChI | InChI=1S/C6H3BrF2/c7-5-3-4(8)1-2-6(5)9/h1-3H | | InChIKey | XCRCSPKQEDMVBO-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(F)C=C1Br | | CAS DataBase Reference | 399-94-0(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 2-bromo-1,4-difluoro-(399-94-0) |
| | 1-Bromo-2,5-difluorobenzene Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | 2-Bromo-1,4-difluorobenzene has been used in the preparation of 1,4-difluoroanthraquinone, a precursor to ametantrone. | | General Description | Lithiation of 2-bromo-1,4-difluorobenzene in the presence of lithium diisopropylamide (LDA) in THF-hexane, butyllithium in diethyl ether-hexane and butyllithium in THF-hexane has been reported. |
| | 1-Bromo-2,5-difluorobenzene Preparation Products And Raw materials |
|